C17H19F6N3O — CID 54578090
1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-[2-(dimethylamino)ethylamino]ethanol (PubChem CID 54578090) has the molecular formula C17H19F6N3O and a molecular weight of 395.35 g/mol. Its IUPAC name is 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-[2-(dimethylamino)ethylamino]ethanol.
| Compound Name | 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-[2-(dimethylamino)ethylamino]ethanol |
|---|---|
| PubChem CID | 54578090 |
| Molecular Formula | C17H19F6N3O |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-[2-(dimethylamino)ethylamino]ethanol |
| SMILES | CN(C)CCNCC(O)c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C17H19F6N3O/c1-26(2)7-6-24-9-13(27)11-8-14(17(21,22)23)25-15-10(11)4-3-5-12(15)16(18,19)20/h3-5,8,13,24,27H,6-7,9H2,1-2H3 |
| InChIKey | YXHSZZPOIVFHSD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|