C17H17F6NO2 — CID 46232979
1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-butoxyethanol (PubChem CID 46232979) has the molecular formula C17H17F6NO2 and a molecular weight of 381.32 g/mol. Its IUPAC name is 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-butoxyethanol.
| Compound Name | 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-butoxyethanol |
|---|---|
| PubChem CID | 46232979 |
| Molecular Formula | C17H17F6NO2 |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-butoxyethanol |
| SMILES | CCCCOCC(O)c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C17H17F6NO2/c1-2-3-7-26-9-13(25)11-8-14(17(21,22)23)24-15-10(11)5-4-6-12(15)16(18,19)20/h4-6,8,13,25H,2-3,7,9H2,1H3 |
| InChIKey | ZBVPAPVVMYMMBS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|