About CID 46897345
CID 46897345 (PubChem CID 46897345) has the molecular formula C17H10F6NO
and a molecular weight of 358.26 g/mol.
Molecular Properties
| Compound Name | CID 46897345 |
| PubChem CID | 46897345 |
| Molecular Formula | C17H10F6NO |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | — |
| SMILES | OC([C]1[CH][CH][CH][CH]1)c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C17H10F6NO/c18-16(19,20)12-7-3-6-10-11(15(25)9-4-1-2-5-9)8-13(17(21,22)23)24-14(10)12/h1-8,15,25H |
| InChIKey | IVTUJGHMWUPTKV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 46897345 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 46897345?
The IUPAC name of CID 46897345 (CID 46897345) is not available.
What is the SMILES notation for CID 46897345?
The canonical SMILES for CID 46897345 is OC([C]1[CH][CH][CH][CH]1)c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12.
What is the InChIKey of CID 46897345?
The InChIKey is IVTUJGHMWUPTKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10F6NO/c18-16(19,20)12-7-3-6-10-11(15(25)9-4-1-2-5-9)8-13(17(21,22)23)24-14(10)12/h1-8,15,25H.
What are the key properties of CID 46897345?
CID 46897345 has a molecular weight of 358.26 g/mol, XLogP of 4.71, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 46897345 is sourced from PubChem (CID 46897345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).