C16H14F6N2O — CID 59084682
(S)-[2,8-bis(trifluoromethyl)quinolin-4-yl]-[(2S)-pyrrolidin-2-yl]methanol (PubChem CID 59084682) has the molecular formula C16H14F6N2O and a molecular weight of 364.29 g/mol. Its IUPAC name is (S)-[2,8-bis(trifluoromethyl)quinolin-4-yl]-[(2S)-pyrrolidin-2-yl]methanol.
| Compound Name | (S)-[2,8-bis(trifluoromethyl)quinolin-4-yl]-[(2S)-pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 59084682 |
| Molecular Formula | C16H14F6N2O |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | (S)-[2,8-bis(trifluoromethyl)quinolin-4-yl]-[(2S)-pyrrolidin-2-yl]methanol |
| SMILES | O[C@@H](c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)[C@@H]1CCCN1 |
| InChI | InChI=1S/C16H14F6N2O/c17-15(18,19)10-4-1-3-8-9(14(25)11-5-2-6-23-11)7-12(16(20,21)22)24-13(8)10/h1,3-4,7,11,14,23,25H,2,5-6H2/t11-,14-/m0/s1 |
| InChIKey | KQMDVPHXKCGASU-FZMZJTMJSA-N |
| XLogP | 4.06 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |