C17H20F6N4O — CID 87721844
(S)-[2,8-bis(trifluoromethyl)quinolin-4-yl]-[(2R)-piperidin-2-yl]methanol;hydrazine (PubChem CID 87721844) has the molecular formula C17H20F6N4O and a molecular weight of 410.36 g/mol. Its IUPAC name is (S)-[2,8-bis(trifluoromethyl)quinolin-4-yl]-[(2R)-piperidin-2-yl]methanol;hydrazine.
| Compound Name | (S)-[2,8-bis(trifluoromethyl)quinolin-4-yl]-[(2R)-piperidin-2-yl]methanol;hydrazine |
|---|---|
| PubChem CID | 87721844 |
| Molecular Formula | C17H20F6N4O |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (S)-[2,8-bis(trifluoromethyl)quinolin-4-yl]-[(2R)-piperidin-2-yl]methanol;hydrazine |
| SMILES | NN.O[C@@H](c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)[C@H]1CCCCN1 |
| InChI | InChI=1S/C17H16F6N2O.H4N2/c18-16(19,20)11-5-3-4-9-10(15(26)12-6-1-2-7-24-12)8-13(17(21,22)23)25-14(9)11;1-2/h3-5,8,12,15,24,26H,1-2,6-7H2;1-2H2/t12-,15+;/m1./s1 |
| InChIKey | IPDDTGHJLPRARM-YLCXCWDSSA-N |
| XLogP | 3.27 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|