C23H20F6N2O — CID 10321725
piperidin-2-yl-[8-(trifluoromethyl)-2-[3-(trifluoromethyl)phenyl]quinolin-4-yl]methanol (PubChem CID 10321725) has the molecular formula C23H20F6N2O and a molecular weight of 454.41 g/mol. Its IUPAC name is piperidin-2-yl-[8-(trifluoromethyl)-2-[3-(trifluoromethyl)phenyl]quinolin-4-yl]methanol.
| Compound Name | piperidin-2-yl-[8-(trifluoromethyl)-2-[3-(trifluoromethyl)phenyl]quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 10321725 |
| Molecular Formula | C23H20F6N2O |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | piperidin-2-yl-[8-(trifluoromethyl)-2-[3-(trifluoromethyl)phenyl]quinolin-4-yl]methanol |
| SMILES | OC(c1cc(-c2cccc(C(F)(F)F)c2)nc2c(C(F)(F)F)cccc12)C1CCCCN1 |
| InChI | InChI=1S/C23H20F6N2O/c24-22(25,26)14-6-3-5-13(11-14)19-12-16(21(32)18-9-1-2-10-30-18)15-7-4-8-17(20(15)31-19)23(27,28)29/h3-8,11-12,18,21,30,32H,1-2,9-10H2 |
| InChIKey | FJCHTACKGSXILE-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |