C13H16F3NO — CID 23467209
piperidin-2-yl-[3-(trifluoromethyl)phenyl]methanol (PubChem CID 23467209) has the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. Its IUPAC name is piperidin-2-yl-[3-(trifluoromethyl)phenyl]methanol.
| Compound Name | piperidin-2-yl-[3-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 23467209 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | piperidin-2-yl-[3-(trifluoromethyl)phenyl]methanol |
| SMILES | OC(c1cccc(C(F)(F)F)c1)C1CCCCN1 |
| InChI | InChI=1S/C13H16F3NO/c14-13(15,16)10-5-3-4-9(8-10)12(18)11-6-1-2-7-17-11/h3-5,8,11-12,17-18H,1-2,6-7H2 |
| InChIKey | HREBRFJZIKJWOT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |