C13H17ClFNO — CID 81155319
azepan-2-yl-(3-chloro-4-fluorophenyl)methanol (PubChem CID 81155319) has the molecular formula C13H17ClFNO and a molecular weight of 257.74 g/mol. Its IUPAC name is azepan-2-yl-(3-chloro-4-fluorophenyl)methanol.
| Compound Name | azepan-2-yl-(3-chloro-4-fluorophenyl)methanol |
|---|---|
| PubChem CID | 81155319 |
| Molecular Formula | C13H17ClFNO |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | azepan-2-yl-(3-chloro-4-fluorophenyl)methanol |
| SMILES | OC(c1ccc(F)c(Cl)c1)C1CCCCCN1 |
| InChI | InChI=1S/C13H17ClFNO/c14-10-8-9(5-6-11(10)15)13(17)12-4-2-1-3-7-16-12/h5-6,8,12-13,16-17H,1-4,7H2 |
| InChIKey | NMLFWRICWJEJQH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |