C12H14ClF2NO — CID 107476748
(2-chloro-4,5-difluorophenyl)-piperidin-2-ylmethanol (PubChem CID 107476748) has the molecular formula C12H14ClF2NO and a molecular weight of 261.70 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-piperidin-2-ylmethanol.
| Compound Name | (2-chloro-4,5-difluorophenyl)-piperidin-2-ylmethanol |
|---|---|
| PubChem CID | 107476748 |
| Molecular Formula | C12H14ClF2NO |
| Molecular Weight | 261.70 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-piperidin-2-ylmethanol |
| SMILES | OC(c1cc(F)c(F)cc1Cl)C1CCCCN1 |
| InChI | InChI=1S/C12H14ClF2NO/c13-8-6-10(15)9(14)5-7(8)12(17)11-3-1-2-4-16-11/h5-6,11-12,16-17H,1-4H2 |
| InChIKey | IEJZKKDXYJYNPH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.70 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|