About (4-bromo-2,5-difluorophenyl)-piperidin-2-ylmethanol
(4-bromo-2,5-difluorophenyl)-piperidin-2-ylmethanol (PubChem CID 64866828) has the molecular formula C12H14BrF2NO
and a molecular weight of 306.15 g/mol. Its IUPAC name is (4-bromo-2,5-difluorophenyl)-piperidin-2-ylmethanol.
Molecular Properties
| Compound Name | (4-bromo-2,5-difluorophenyl)-piperidin-2-ylmethanol |
| PubChem CID | 64866828 |
| Molecular Formula | C12H14BrF2NO |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | (4-bromo-2,5-difluorophenyl)-piperidin-2-ylmethanol |
| SMILES | OC(c1cc(F)c(Br)cc1F)C1CCCCN1 |
| InChI | InChI=1S/C12H14BrF2NO/c13-8-6-9(14)7(5-10(8)15)12(17)11-3-1-2-4-16-11/h5-6,11-12,16-17H,1-4H2 |
| InChIKey | SINXFVMZESLNBU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-2,5-difluorophenyl)-piperidin-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2,5-difluorophenyl)-piperidin-2-ylmethanol?
The IUPAC name of (4-bromo-2,5-difluorophenyl)-piperidin-2-ylmethanol (CID 64866828) is (4-bromo-2,5-difluorophenyl)-piperidin-2-ylmethanol.
What is the SMILES notation for (4-bromo-2,5-difluorophenyl)-piperidin-2-ylmethanol?
The canonical SMILES for (4-bromo-2,5-difluorophenyl)-piperidin-2-ylmethanol is OC(c1cc(F)c(Br)cc1F)C1CCCCN1.
What is the InChIKey of (4-bromo-2,5-difluorophenyl)-piperidin-2-ylmethanol?
The InChIKey is SINXFVMZESLNBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrF2NO/c13-8-6-9(14)7(5-10(8)15)12(17)11-3-1-2-4-16-11/h5-6,11-12,16-17H,1-4H2.
What are the key properties of (4-bromo-2,5-difluorophenyl)-piperidin-2-ylmethanol?
(4-bromo-2,5-difluorophenyl)-piperidin-2-ylmethanol has a molecular weight of 306.15 g/mol, XLogP of 2.90, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2,5-difluorophenyl)-piperidin-2-ylmethanol is sourced from PubChem (CID 64866828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).