C12H16ClFN2 — CID 116950939
1-(3-chloro-4-fluorophenyl)-N-methyl-1-pyrrolidin-2-ylmethanamine (PubChem CID 116950939) has the molecular formula C12H16ClFN2 and a molecular weight of 242.72 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-N-methyl-1-pyrrolidin-2-ylmethanamine.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-N-methyl-1-pyrrolidin-2-ylmethanamine |
|---|---|
| PubChem CID | 116950939 |
| Molecular Formula | C12H16ClFN2 |
| Molecular Weight | 242.72 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-N-methyl-1-pyrrolidin-2-ylmethanamine |
| SMILES | CNC(c1ccc(F)c(Cl)c1)C1CCCN1 |
| InChI | InChI=1S/C12H16ClFN2/c1-15-12(11-3-2-6-16-11)8-4-5-10(14)9(13)7-8/h4-5,7,11-12,15-16H,2-3,6H2,1H3 |
| InChIKey | CQASDJGCRVPNGE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.72 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |