C17H15F6NO — CID 59451320
[2,8-bis(trifluoromethyl)quinolin-4-yl]-cyclopentylmethanol (PubChem CID 59451320) has the molecular formula C17H15F6NO and a molecular weight of 363.30 g/mol. Its IUPAC name is [2,8-bis(trifluoromethyl)quinolin-4-yl]-cyclopentylmethanol.
| Compound Name | [2,8-bis(trifluoromethyl)quinolin-4-yl]-cyclopentylmethanol |
|---|---|
| PubChem CID | 59451320 |
| Molecular Formula | C17H15F6NO |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | [2,8-bis(trifluoromethyl)quinolin-4-yl]-cyclopentylmethanol |
| SMILES | OC(c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)C1CCCC1 |
| InChI | InChI=1S/C17H15F6NO/c18-16(19,20)12-7-3-6-10-11(15(25)9-4-1-2-5-9)8-13(17(21,22)23)24-14(10)12/h3,6-9,15,25H,1-2,4-5H2 |
| InChIKey | DSXUZMCUDQCJQC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |