C20H23F6N3O — CID 71592220
[2,8-bis(trifluoromethyl)quinolin-4-yl]-[1-(cyclopentylamino)propan-2-ylamino]methanol (PubChem CID 71592220) has the molecular formula C20H23F6N3O and a molecular weight of 435.41 g/mol. Its IUPAC name is [2,8-bis(trifluoromethyl)quinolin-4-yl]-[1-(cyclopentylamino)propan-2-ylamino]methanol.
| Compound Name | [2,8-bis(trifluoromethyl)quinolin-4-yl]-[1-(cyclopentylamino)propan-2-ylamino]methanol |
|---|---|
| PubChem CID | 71592220 |
| Molecular Formula | C20H23F6N3O |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | [2,8-bis(trifluoromethyl)quinolin-4-yl]-[1-(cyclopentylamino)propan-2-ylamino]methanol |
| SMILES | CC(CNC1CCCC1)NC(O)c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C20H23F6N3O/c1-11(10-27-12-5-2-3-6-12)28-18(30)14-9-16(20(24,25)26)29-17-13(14)7-4-8-15(17)19(21,22)23/h4,7-9,11-12,18,27-28,30H,2-3,5-6,10H2,1H3 |
| InChIKey | MJLATRLWQJOODH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|