About CID 71466931
CID 71466931 (PubChem CID 71466931) has the molecular formula C16H8F6NO
and a molecular weight of 344.23 g/mol.
Molecular Properties
| Compound Name | CID 71466931 |
| PubChem CID | 71466931 |
| Molecular Formula | C16H8F6NO |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | — |
| SMILES | FC(F)(F)c1cc(O[C]2[CH][CH][CH][CH]2)c2cccc(C(F)(F)F)c2n1 |
| InChI | InChI=1S/C16H8F6NO/c17-15(18,19)11-7-3-6-10-12(24-9-4-1-2-5-9)8-13(16(20,21)22)23-14(10)11/h1-8H |
| InChIKey | OXWQITMZYDKPIN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 71466931 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71466931?
The IUPAC name of CID 71466931 (CID 71466931) is not available.
What is the SMILES notation for CID 71466931?
The canonical SMILES for CID 71466931 is FC(F)(F)c1cc(O[C]2[CH][CH][CH][CH]2)c2cccc(C(F)(F)F)c2n1.
What is the InChIKey of CID 71466931?
The InChIKey is OXWQITMZYDKPIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8F6NO/c17-15(18,19)11-7-3-6-10-12(24-9-4-1-2-5-9)8-13(16(20,21)22)23-14(10)11/h1-8H.
What are the key properties of CID 71466931?
CID 71466931 has a molecular weight of 344.23 g/mol, XLogP of 5.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71466931 is sourced from PubChem (CID 71466931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).