C23H24F6N2OSi — CID 14254845
[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-tert-butyl-dimethylsilane (PubChem CID 14254845) has the molecular formula C23H24F6N2OSi and a molecular weight of 486.53 g/mol. Its IUPAC name is [[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-tert-butyl-dimethylsilane.
| Compound Name | [[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 14254845 |
| Molecular Formula | C23H24F6N2OSi |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | [[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)C(Oc1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)c1ccccn1 |
| InChI | InChI=1S/C23H24F6N2OSi/c1-21(2,3)33(4,5)20(16-11-6-7-12-30-16)32-17-13-18(23(27,28)29)31-19-14(17)9-8-10-15(19)22(24,25)26/h6-13,20H,1-5H3 |
| InChIKey | BDNKOVDNMRPJQM-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|