C33H14F12N4O — CID 3015810
bis[3-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-pyridinyl]methanone (PubChem CID 3015810) has the molecular formula C33H14F12N4O and a molecular weight of 710.48 g/mol. Its IUPAC name is bis[3-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-pyridinyl]methanone.
| Compound Name | bis[3-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 3015810 |
| Molecular Formula | C33H14F12N4O |
| Molecular Weight | 710.48 g/mol |
| Exact Mass | 710.10 |
| IUPAC Name | bis[3-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-pyridinyl]methanone |
| SMILES | O=C(c1ncccc1-c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)c1ncccc1-c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C33H14F12N4O/c34-30(35,36)21-9-1-5-15-19(13-23(32(40,41)42)48-25(15)21)17-7-3-11-46-27(17)29(50)28-18(8-4-12-47-28)20-14-24(33(43,44)45)49-26-16(20)6-2-10-22(26)31(37,38)39/h1-14H |
| InChIKey | BRBWPXWUHSCFBB-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.48 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |