About [[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-trimethylsilane
[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-trimethylsilane (PubChem CID 23256517) has the molecular formula C20H18F6N2OSi
and a molecular weight of 444.45 g/mol. Its IUPAC name is [[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-trimethylsilane.
Molecular Properties
| Compound Name | [[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-trimethylsilane |
| PubChem CID | 23256517 |
| Molecular Formula | C20H18F6N2OSi |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | [[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C(Oc1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)c1ccccn1 |
| InChI | InChI=1S/C20H18F6N2OSi/c1-30(2,3)18(14-9-4-5-10-27-14)29-15-11-16(20(24,25)26)28-17-12(15)7-6-8-13(17)19(21,22)23/h4-11,18H,1-3H3 |
| InChIKey | IRVTVPCRSBFFHG-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-trimethylsilane?
The IUPAC name of [[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-trimethylsilane (CID 23256517) is [[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-trimethylsilane.
What is the SMILES notation for [[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-trimethylsilane?
The canonical SMILES for [[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-trimethylsilane is C[Si](C)(C)C(Oc1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)c1ccccn1.
What is the InChIKey of [[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-trimethylsilane?
The InChIKey is IRVTVPCRSBFFHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18F6N2OSi/c1-30(2,3)18(14-9-4-5-10-27-14)29-15-11-16(20(24,25)26)28-17-12(15)7-6-8-13(17)19(21,22)23/h4-11,18H,1-3H3.
What are the key properties of [[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-trimethylsilane?
[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-trimethylsilane has a molecular weight of 444.45 g/mol, XLogP of 6.66, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-trimethylsilane is sourced from PubChem (CID 23256517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).