C20H18F6N2OSi — CID 23256517
[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-trimethylsilane (PubChem CID 23256517) has the molecular formula C20H18F6N2OSi and a molecular weight of 444.45 g/mol. Its IUPAC name is [[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-trimethylsilane.
| Compound Name | [[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-trimethylsilane |
|---|---|
| PubChem CID | 23256517 |
| Molecular Formula | C20H18F6N2OSi |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | [[2,8-bis(trifluoromethyl)quinolin-4-yl]oxy-pyridin-2-ylmethyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C(Oc1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)c1ccccn1 |
| InChI | InChI=1S/C20H18F6N2OSi/c1-30(2,3)18(14-9-4-5-10-27-14)29-15-11-16(20(24,25)26)28-17-12(15)7-6-8-13(17)19(21,22)23/h4-11,18H,1-3H3 |
| InChIKey | IRVTVPCRSBFFHG-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|