C22H20F6N2O4 — CID 46230031
hexyl 5-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]-1,2-oxazole-3-carboxylate (PubChem CID 46230031) has the molecular formula C22H20F6N2O4 and a molecular weight of 490.40 g/mol. Its IUPAC name is hexyl 5-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]-1,2-oxazole-3-carboxylate.
| Compound Name | hexyl 5-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 46230031 |
| Molecular Formula | C22H20F6N2O4 |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | hexyl 5-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]-1,2-oxazole-3-carboxylate |
| SMILES | CCCCCCOC(=O)c1cc(COc2cc(C(F)(F)F)nc3c(C(F)(F)F)cccc23)on1 |
| InChI | InChI=1S/C22H20F6N2O4/c1-2-3-4-5-9-32-20(31)16-10-13(34-30-16)12-33-17-11-18(22(26,27)28)29-19-14(17)7-6-8-15(19)21(23,24)25/h6-8,10-11H,2-5,9,12H2,1H3 |
| InChIKey | NUQKANHXLKOPTD-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.40 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|