C22H22F4O4 — CID 91738377
4-O-[2-fluoro-3-(trifluoromethyl)phenyl] 1-O-heptyl benzene-1,4-dicarboxylate (PubChem CID 91738377) has the molecular formula C22H22F4O4 and a molecular weight of 426.41 g/mol. Its IUPAC name is 4-O-[2-fluoro-3-(trifluoromethyl)phenyl] 1-O-heptyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[2-fluoro-3-(trifluoromethyl)phenyl] 1-O-heptyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91738377 |
| Molecular Formula | C22H22F4O4 |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 4-O-[2-fluoro-3-(trifluoromethyl)phenyl] 1-O-heptyl benzene-1,4-dicarboxylate |
| SMILES | CCCCCCCOC(=O)c1ccc(C(=O)Oc2cccc(C(F)(F)F)c2F)cc1 |
| InChI | InChI=1S/C22H22F4O4/c1-2-3-4-5-6-14-29-20(27)15-10-12-16(13-11-15)21(28)30-18-9-7-8-17(19(18)23)22(24,25)26/h7-13H,2-6,14H2,1H3 |
| InChIKey | GEYKFYHWWVYHQS-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|