C23H32F4O4 — CID 91705355
1-O-[2-fluoro-3-(trifluoromethyl)phenyl] 3-O-nonyl 2,2-diethylpropanedioate (PubChem CID 91705355) has the molecular formula C23H32F4O4 and a molecular weight of 448.50 g/mol. Its IUPAC name is 1-O-[2-fluoro-3-(trifluoromethyl)phenyl] 3-O-nonyl 2,2-diethylpropanedioate.
| Compound Name | 1-O-[2-fluoro-3-(trifluoromethyl)phenyl] 3-O-nonyl 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91705355 |
| Molecular Formula | C23H32F4O4 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 1-O-[2-fluoro-3-(trifluoromethyl)phenyl] 3-O-nonyl 2,2-diethylpropanedioate |
| SMILES | CCCCCCCCCOC(=O)C(CC)(CC)C(=O)Oc1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C23H32F4O4/c1-4-7-8-9-10-11-12-16-30-20(28)22(5-2,6-3)21(29)31-18-15-13-14-17(19(18)24)23(25,26)27/h13-15H,4-12,16H2,1-3H3 |
| InChIKey | JWILIEFMYHJUQV-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|