C22H30F4O4 — CID 91705976
1-O-[2-fluoro-3-(trifluoromethyl)phenyl] 3-O-octyl 2,2-diethylpropanedioate (PubChem CID 91705976) has the molecular formula C22H30F4O4 and a molecular weight of 434.47 g/mol. Its IUPAC name is 1-O-[2-fluoro-3-(trifluoromethyl)phenyl] 3-O-octyl 2,2-diethylpropanedioate.
| Compound Name | 1-O-[2-fluoro-3-(trifluoromethyl)phenyl] 3-O-octyl 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91705976 |
| Molecular Formula | C22H30F4O4 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 1-O-[2-fluoro-3-(trifluoromethyl)phenyl] 3-O-octyl 2,2-diethylpropanedioate |
| SMILES | CCCCCCCCOC(=O)C(CC)(CC)C(=O)Oc1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C22H30F4O4/c1-4-7-8-9-10-11-15-29-19(27)21(5-2,6-3)20(28)30-17-14-12-13-16(18(17)23)22(24,25)26/h12-14H,4-11,15H2,1-3H3 |
| InChIKey | IFBTZBIALJEEHD-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|