C18H14F4O4 — CID 91730797
4-O-[2-fluoro-3-(trifluoromethyl)phenyl] 1-O-propyl benzene-1,4-dicarboxylate (PubChem CID 91730797) has the molecular formula C18H14F4O4 and a molecular weight of 370.30 g/mol. Its IUPAC name is 4-O-[2-fluoro-3-(trifluoromethyl)phenyl] 1-O-propyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[2-fluoro-3-(trifluoromethyl)phenyl] 1-O-propyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91730797 |
| Molecular Formula | C18H14F4O4 |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 4-O-[2-fluoro-3-(trifluoromethyl)phenyl] 1-O-propyl benzene-1,4-dicarboxylate |
| SMILES | CCCOC(=O)c1ccc(C(=O)Oc2cccc(C(F)(F)F)c2F)cc1 |
| InChI | InChI=1S/C18H14F4O4/c1-2-10-25-16(23)11-6-8-12(9-7-11)17(24)26-14-5-3-4-13(15(14)19)18(20,21)22/h3-9H,2,10H2,1H3 |
| InChIKey | PIUWDMJEARXIIN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|