About CID 46861677
CID 46861677 (PubChem CID 46861677) has the molecular formula C34H19ClF12FeN2O2+2
and a molecular weight of 806.81 g/mol.
Molecular Properties
| Compound Name | CID 46861677 |
| PubChem CID | 46861677 |
| Molecular Formula | C34H19ClF12FeN2O2+2 |
| Molecular Weight | 806.81 g/mol |
| Exact Mass | 806.03 |
| IUPAC Name | — |
| SMILES | FC(F)(F)c1cc(OC[C]2[CH][CH][CH][CH]2)c2ccc(Cl)c(C(F)(F)F)c2n1.FC(F)(F)c1cc(OC[C]2[CH][CH][CH][CH]2)c2cccc(C(F)(F)F)c2n1.[Fe+2] |
| InChI | InChI=1S/C17H9ClF6NO.C17H10F6NO.Fe/c18-11-6-5-10-12(26-8-9-3-1-2-4-9)7-13(16(19,20)21)25-15(10)14(11)17(22,23)24;18-16(19,20)12-7-3-6-11-13(25-9-10-4-1-2-5-10)8-14(17(21,22)23)24-15(11)12;/h1-7H,8H2;1-8H,9H2;/q;;+2 |
| InChIKey | YOORBOIVSZNLEU-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 806.81 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 46861677 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 46861677?
The IUPAC name of CID 46861677 (CID 46861677) is not available.
What is the SMILES notation for CID 46861677?
The canonical SMILES for CID 46861677 is FC(F)(F)c1cc(OC[C]2[CH][CH][CH][CH]2)c2ccc(Cl)c(C(F)(F)F)c2n1.FC(F)(F)c1cc(OC[C]2[CH][CH][CH][CH]2)c2cccc(C(F)(F)F)c2n1.[Fe+2].
What is the InChIKey of CID 46861677?
The InChIKey is YOORBOIVSZNLEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9ClF6NO.C17H10F6NO.Fe/c18-11-6-5-10-12(26-8-9-3-1-2-4-9)7-13(16(19,20)21)25-15(10)14(11)17(22,23)24;18-16(19,20)12-7-3-6-11-13(25-9-10-4-1-2-5-10)8-14(17(21,22)23)24-15(11)12;/h1-7H,8H2;1-8H,9H2;/q;;+2.
What are the key properties of CID 46861677?
CID 46861677 has a molecular weight of 806.81 g/mol, XLogP of 10.76, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 46861677 is sourced from PubChem (CID 46861677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).