C34H19ClF12FeN2O2+2 — CID 46861677
CID 46861677 (PubChem CID 46861677) has the molecular formula C34H19ClF12FeN2O2+2 and a molecular weight of 806.81 g/mol.
| Compound Name | CID 46861677 |
|---|---|
| PubChem CID | 46861677 |
| Molecular Formula | C34H19ClF12FeN2O2+2 |
| Molecular Weight | 806.81 g/mol |
| Exact Mass | 806.03 |
| IUPAC Name | — |
| SMILES | FC(F)(F)c1cc(OC[C]2[CH][CH][CH][CH]2)c2ccc(Cl)c(C(F)(F)F)c2n1.FC(F)(F)c1cc(OC[C]2[CH][CH][CH][CH]2)c2cccc(C(F)(F)F)c2n1.[Fe+2] |
| InChI | InChI=1S/C17H9ClF6NO.C17H10F6NO.Fe/c18-11-6-5-10-12(26-8-9-3-1-2-4-9)7-13(16(19,20)21)25-15(10)14(11)17(22,23)24;18-16(19,20)12-7-3-6-11-13(25-9-10-4-1-2-5-10)8-14(17(21,22)23)24-15(11)12;/h1-7H,8H2;1-8H,9H2;/q;;+2 |
| InChIKey | YOORBOIVSZNLEU-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.81 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|