C29H24F6N2O6S — CID 151253829
methyl 2-[[4-[4-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]phenyl]phenyl]sulfonylamino]-2-hydroxybutanoate (PubChem CID 151253829) has the molecular formula C29H24F6N2O6S and a molecular weight of 642.57 g/mol. Its IUPAC name is methyl 2-[[4-[4-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]phenyl]phenyl]sulfonylamino]-2-hydroxybutanoate.
| Compound Name | methyl 2-[[4-[4-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]phenyl]phenyl]sulfonylamino]-2-hydroxybutanoate |
|---|---|
| PubChem CID | 151253829 |
| Molecular Formula | C29H24F6N2O6S |
| Molecular Weight | 642.57 g/mol |
| Exact Mass | 642.13 |
| IUPAC Name | methyl 2-[[4-[4-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]phenyl]phenyl]sulfonylamino]-2-hydroxybutanoate |
| SMILES | CCC(O)(NS(=O)(=O)c1ccc(-c2ccc(COc3cc(C(F)(F)F)nc4c(C(F)(F)F)cccc34)cc2)cc1)C(=O)OC |
| InChI | InChI=1S/C29H24F6N2O6S/c1-3-27(39,26(38)42-2)37-44(40,41)20-13-11-19(12-14-20)18-9-7-17(8-10-18)16-43-23-15-24(29(33,34)35)36-25-21(23)5-4-6-22(25)28(30,31)32/h4-15,37,39H,3,16H2,1-2H3 |
| InChIKey | NSWZUDVLFSNPPT-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.57 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|