C17H10F6N2 — CID 16728100
3-[2,8-bis(trifluoromethyl)quinolin-4-yl]aniline (PubChem CID 16728100) has the molecular formula C17H10F6N2 and a molecular weight of 356.27 g/mol. Its IUPAC name is 3-[2,8-bis(trifluoromethyl)quinolin-4-yl]aniline.
| Compound Name | 3-[2,8-bis(trifluoromethyl)quinolin-4-yl]aniline |
|---|---|
| PubChem CID | 16728100 |
| Molecular Formula | C17H10F6N2 |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 3-[2,8-bis(trifluoromethyl)quinolin-4-yl]aniline |
| SMILES | Nc1cccc(-c2cc(C(F)(F)F)nc3c(C(F)(F)F)cccc23)c1 |
| InChI | InChI=1S/C17H10F6N2/c18-16(19,20)13-6-2-5-11-12(9-3-1-4-10(24)7-9)8-14(17(21,22)23)25-15(11)13/h1-8H,24H2 |
| InChIKey | VWVVRXUPXMECTD-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|