C20H16F6N4 — CID 171686339
4-(2-piperazin-1-yl-4-pyridinyl)-2,8-bis(trifluoromethyl)quinoline (PubChem CID 171686339) has the molecular formula C20H16F6N4 and a molecular weight of 426.36 g/mol. Its IUPAC name is 4-(2-piperazin-1-yl-4-pyridinyl)-2,8-bis(trifluoromethyl)quinoline.
| Compound Name | 4-(2-piperazin-1-yl-4-pyridinyl)-2,8-bis(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 171686339 |
| Molecular Formula | C20H16F6N4 |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 4-(2-piperazin-1-yl-4-pyridinyl)-2,8-bis(trifluoromethyl)quinoline |
| SMILES | FC(F)(F)c1cc(-c2ccnc(N3CCNCC3)c2)c2cccc(C(F)(F)F)c2n1 |
| InChI | InChI=1S/C20H16F6N4/c21-19(22,23)15-3-1-2-13-14(11-16(20(24,25)26)29-18(13)15)12-4-5-28-17(10-12)30-8-6-27-7-9-30/h1-5,10-11,27H,6-9H2 |
| InChIKey | BCGQSCQBDOWSRW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |