C25H23N5 — CID 171686343
2,4-diphenyl-6-(2-piperazin-1-yl-4-pyridinyl)pyrimidine (PubChem CID 171686343) has the molecular formula C25H23N5 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2,4-diphenyl-6-(2-piperazin-1-yl-4-pyridinyl)pyrimidine.
| Compound Name | 2,4-diphenyl-6-(2-piperazin-1-yl-4-pyridinyl)pyrimidine |
|---|---|
| PubChem CID | 171686343 |
| Molecular Formula | C25H23N5 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 2,4-diphenyl-6-(2-piperazin-1-yl-4-pyridinyl)pyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccnc(N4CCNCC4)c3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C25H23N5/c1-3-7-19(8-4-1)22-18-23(29-25(28-22)20-9-5-2-6-10-20)21-11-12-27-24(17-21)30-15-13-26-14-16-30/h1-12,17-18,26H,13-16H2 |
| InChIKey | LJTZXNMDGHZVRG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |