C17H20F3N3 — CID 121236577
4-piperazin-1-yl-2-propyl-8-(trifluoromethyl)quinoline (PubChem CID 121236577) has the molecular formula C17H20F3N3 and a molecular weight of 323.36 g/mol. Its IUPAC name is 4-piperazin-1-yl-2-propyl-8-(trifluoromethyl)quinoline.
| Compound Name | 4-piperazin-1-yl-2-propyl-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 121236577 |
| Molecular Formula | C17H20F3N3 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 4-piperazin-1-yl-2-propyl-8-(trifluoromethyl)quinoline |
| SMILES | CCCc1cc(N2CCNCC2)c2cccc(C(F)(F)F)c2n1 |
| InChI | InChI=1S/C17H20F3N3/c1-2-4-12-11-15(23-9-7-21-8-10-23)13-5-3-6-14(16(13)22-12)17(18,19)20/h3,5-6,11,21H,2,4,7-10H2,1H3 |
| InChIKey | GVPBUXLYMMUQJX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |