C17H21ClF3N3O — CID 121236574
4-piperazin-1-yl-2-propyl-8-(trifluoromethoxy)quinoline;hydrochloride (PubChem CID 121236574) has the molecular formula C17H21ClF3N3O and a molecular weight of 375.82 g/mol. Its IUPAC name is 4-piperazin-1-yl-2-propyl-8-(trifluoromethoxy)quinoline;hydrochloride.
| Compound Name | 4-piperazin-1-yl-2-propyl-8-(trifluoromethoxy)quinoline;hydrochloride |
|---|---|
| PubChem CID | 121236574 |
| Molecular Formula | C17H21ClF3N3O |
| Molecular Weight | 375.82 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 4-piperazin-1-yl-2-propyl-8-(trifluoromethoxy)quinoline;hydrochloride |
| SMILES | CCCc1cc(N2CCNCC2)c2cccc(OC(F)(F)F)c2n1.Cl |
| InChI | InChI=1S/C17H20F3N3O.ClH/c1-2-4-12-11-14(23-9-7-21-8-10-23)13-5-3-6-15(16(13)22-12)24-17(18,19)20;/h3,5-6,11,21H,2,4,7-10H2,1H3;1H |
| InChIKey | LHNLFXPFOZGJMC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.82 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |