C14H20F3N3 — CID 177040771
1-[2-methyl-3-propyl-6-(trifluoromethyl)-4-pyridinyl]piperazine (PubChem CID 177040771) has the molecular formula C14H20F3N3 and a molecular weight of 287.33 g/mol. Its IUPAC name is 1-[2-methyl-3-propyl-6-(trifluoromethyl)-4-pyridinyl]piperazine.
| Compound Name | 1-[2-methyl-3-propyl-6-(trifluoromethyl)-4-pyridinyl]piperazine |
|---|---|
| PubChem CID | 177040771 |
| Molecular Formula | C14H20F3N3 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 1-[2-methyl-3-propyl-6-(trifluoromethyl)-4-pyridinyl]piperazine |
| SMILES | CCCc1c(N2CCNCC2)cc(C(F)(F)F)nc1C |
| InChI | InChI=1S/C14H20F3N3/c1-3-4-11-10(2)19-13(14(15,16)17)9-12(11)20-7-5-18-6-8-20/h9,18H,3-8H2,1-2H3 |
| InChIKey | XOVZQJIJBCDYLG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |