C10H15Cl2F3N4 — CID 166606228
2-methyl-4-piperazin-1-yl-6-(trifluoromethyl)pyrimidine;dihydrochloride (PubChem CID 166606228) has the molecular formula C10H15Cl2F3N4 and a molecular weight of 319.16 g/mol. Its IUPAC name is 2-methyl-4-piperazin-1-yl-6-(trifluoromethyl)pyrimidine;dihydrochloride.
| Compound Name | 2-methyl-4-piperazin-1-yl-6-(trifluoromethyl)pyrimidine;dihydrochloride |
|---|---|
| PubChem CID | 166606228 |
| Molecular Formula | C10H15Cl2F3N4 |
| Molecular Weight | 319.16 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 2-methyl-4-piperazin-1-yl-6-(trifluoromethyl)pyrimidine;dihydrochloride |
| SMILES | Cc1nc(N2CCNCC2)cc(C(F)(F)F)n1.Cl.Cl |
| InChI | InChI=1S/C10H13F3N4.2ClH/c1-7-15-8(10(11,12)13)6-9(16-7)17-4-2-14-3-5-17;;/h6,14H,2-5H2,1H3;2*1H |
| InChIKey | IYGKTIPVXKEKTP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.16 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |