C10H4F6N2 — CID 165175632
2,4-bis(trifluoromethyl)-1,8-naphthyridine (PubChem CID 165175632) has the molecular formula C10H4F6N2 and a molecular weight of 266.14 g/mol. Its IUPAC name is 2,4-bis(trifluoromethyl)-1,8-naphthyridine.
| Compound Name | 2,4-bis(trifluoromethyl)-1,8-naphthyridine |
|---|---|
| PubChem CID | 165175632 |
| Molecular Formula | C10H4F6N2 |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 2,4-bis(trifluoromethyl)-1,8-naphthyridine |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)c2cccnc2n1 |
| InChI | InChI=1S/C10H4F6N2/c11-9(12,13)6-4-7(10(14,15)16)18-8-5(6)2-1-3-17-8/h1-4H |
| InChIKey | JIBDDXAEPNPRCG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |