C15H20F3NO2 — CID 62358371
2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]cyclohexan-1-ol (PubChem CID 62358371) has the molecular formula C15H20F3NO2 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]cyclohexan-1-ol.
| Compound Name | 2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 62358371 |
| Molecular Formula | C15H20F3NO2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]cyclohexan-1-ol |
| SMILES | OC(CNC1CCCCC1O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H20F3NO2/c16-15(17,18)11-5-3-4-10(8-11)14(21)9-19-12-6-1-2-7-13(12)20/h3-5,8,12-14,19-21H,1-2,6-7,9H2 |
| InChIKey | RULORHNTHLBAFS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |