C14H17F3N2O2 — CID 111108610
1-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]-3-(2-methylcyclopropyl)urea (PubChem CID 111108610) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is 1-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]-3-(2-methylcyclopropyl)urea.
| Compound Name | 1-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]-3-(2-methylcyclopropyl)urea |
|---|---|
| PubChem CID | 111108610 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 1-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]-3-(2-methylcyclopropyl)urea |
| SMILES | CC1CC1NC(=O)NCC(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3N2O2/c1-8-5-11(8)19-13(21)18-7-12(20)9-3-2-4-10(6-9)14(15,16)17/h2-4,6,8,11-12,20H,5,7H2,1H3,(H2,18,19,21) |
| InChIKey | MBWCVVUXUHHWLB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |