C14H18F3NO3 — CID 111108654
N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]-2-propoxyacetamide (PubChem CID 111108654) has the molecular formula C14H18F3NO3 and a molecular weight of 305.30 g/mol. Its IUPAC name is N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]-2-propoxyacetamide.
| Compound Name | N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]-2-propoxyacetamide |
|---|---|
| PubChem CID | 111108654 |
| Molecular Formula | C14H18F3NO3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]-2-propoxyacetamide |
| SMILES | CCCOCC(=O)NCC(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18F3NO3/c1-2-6-21-9-13(20)18-8-12(19)10-4-3-5-11(7-10)14(15,16)17/h3-5,7,12,19H,2,6,8-9H2,1H3,(H,18,20) |
| InChIKey | YAFLLAAQQCNFEI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|