C11H18N2S — CID 69494477
(1R)-N'-cyclopentyl-1-thiophen-3-ylethane-1,2-diamine (PubChem CID 69494477) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is (1R)-N'-cyclopentyl-1-thiophen-3-ylethane-1,2-diamine.
| Compound Name | (1R)-N'-cyclopentyl-1-thiophen-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 69494477 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (1R)-N'-cyclopentyl-1-thiophen-3-ylethane-1,2-diamine |
| SMILES | N[C@@H](CNC1CCCC1)c1ccsc1 |
| InChI | InChI=1S/C11H18N2S/c12-11(9-5-6-14-8-9)7-13-10-3-1-2-4-10/h5-6,8,10-11,13H,1-4,7,12H2/t11-/m0/s1 |
| InChIKey | ZWQNPGWWHQDDHO-NSHDSACASA-N |
| XLogP | 2.28 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |