C18H17F3O4S — CID 55443512
[4-(trifluoromethyl)phenyl]methyl 3-(4-methylphenyl)sulfonylpropanoate (PubChem CID 55443512) has the molecular formula C18H17F3O4S and a molecular weight of 386.39 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl]methyl 3-(4-methylphenyl)sulfonylpropanoate.
| Compound Name | [4-(trifluoromethyl)phenyl]methyl 3-(4-methylphenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 55443512 |
| Molecular Formula | C18H17F3O4S |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]methyl 3-(4-methylphenyl)sulfonylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)OCc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H17F3O4S/c1-13-2-8-16(9-3-13)26(23,24)11-10-17(22)25-12-14-4-6-15(7-5-14)18(19,20)21/h2-9H,10-12H2,1H3 |
| InChIKey | TYIZNDGNLFFRGJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |