C14H17NO4S — CID 55355113
3-cyanopropyl 3-(4-methylphenyl)sulfonylpropanoate (PubChem CID 55355113) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is 3-cyanopropyl 3-(4-methylphenyl)sulfonylpropanoate.
| Compound Name | 3-cyanopropyl 3-(4-methylphenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 55355113 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 3-cyanopropyl 3-(4-methylphenyl)sulfonylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)OCCCC#N)cc1 |
| InChI | InChI=1S/C14H17NO4S/c1-12-4-6-13(7-5-12)20(17,18)11-8-14(16)19-10-3-2-9-15/h4-7H,2-3,8,10-11H2,1H3 |
| InChIKey | YHZGKWHNHIIOMY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|