C13H17NO5S — CID 7168654
[(2S)-1-amino-1-oxopropan-2-yl] 3-(4-methylphenyl)sulfonylpropanoate (PubChem CID 7168654) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 3-(4-methylphenyl)sulfonylpropanoate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 3-(4-methylphenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 7168654 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 3-(4-methylphenyl)sulfonylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)O[C@@H](C)C(N)=O)cc1 |
| InChI | InChI=1S/C13H17NO5S/c1-9-3-5-11(6-4-9)20(17,18)8-7-12(15)19-10(2)13(14)16/h3-6,10H,7-8H2,1-2H3,(H2,14,16)/t10-/m0/s1 |
| InChIKey | PSUSYEFOWKEIFO-JTQLQIEISA-N |
| XLogP | 0.58 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |