C18H20O4S — CID 55303928
(4-methylphenyl)methyl 3-(4-methylphenyl)sulfonylpropanoate (PubChem CID 55303928) has the molecular formula C18H20O4S and a molecular weight of 332.42 g/mol. Its IUPAC name is (4-methylphenyl)methyl 3-(4-methylphenyl)sulfonylpropanoate.
| Compound Name | (4-methylphenyl)methyl 3-(4-methylphenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 55303928 |
| Molecular Formula | C18H20O4S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | (4-methylphenyl)methyl 3-(4-methylphenyl)sulfonylpropanoate |
| SMILES | Cc1ccc(COC(=O)CCS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H20O4S/c1-14-3-7-16(8-4-14)13-22-18(19)11-12-23(20,21)17-9-5-15(2)6-10-17/h3-10H,11-13H2,1-2H3 |
| InChIKey | KCBMIUQCDWSOQL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |