C21H25NO5S — CID 55303965
[2-[benzyl(ethyl)amino]-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate (PubChem CID 55303965) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is [2-[benzyl(ethyl)amino]-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate.
| Compound Name | [2-[benzyl(ethyl)amino]-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 55303965 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [2-[benzyl(ethyl)amino]-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate |
| SMILES | CCN(Cc1ccccc1)C(=O)COC(=O)CCS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H25NO5S/c1-3-22(15-18-7-5-4-6-8-18)20(23)16-27-21(24)13-14-28(25,26)19-11-9-17(2)10-12-19/h4-12H,3,13-16H2,1-2H3 |
| InChIKey | OLKNEMJCMVVIPI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |