C20H23NO5S — CID 40781183
[2-(N-ethylanilino)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate (PubChem CID 40781183) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is [2-(N-ethylanilino)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate.
| Compound Name | [2-(N-ethylanilino)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 40781183 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | [2-(N-ethylanilino)-2-oxoethyl] 3-(4-methylphenyl)sulfonylpropanoate |
| SMILES | CCN(C(=O)COC(=O)CCS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H23NO5S/c1-3-21(17-7-5-4-6-8-17)19(22)15-26-20(23)13-14-27(24,25)18-11-9-16(2)10-12-18/h4-12H,3,13-15H2,1-2H3 |
| InChIKey | YOPUPSJQIPQEPM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |