C20H24N2O7S2 — CID 40778059
[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 3-(4-methylphenyl)sulfonylpropanoate (PubChem CID 40778059) has the molecular formula C20H24N2O7S2 and a molecular weight of 468.55 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 3-(4-methylphenyl)sulfonylpropanoate.
| Compound Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 3-(4-methylphenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 40778059 |
| Molecular Formula | C20H24N2O7S2 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 3-(4-methylphenyl)sulfonylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)OCC(=O)NCCc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C20H24N2O7S2/c1-15-2-6-17(7-3-15)30(25,26)13-11-20(24)29-14-19(23)22-12-10-16-4-8-18(9-5-16)31(21,27)28/h2-9H,10-14H2,1H3,(H,22,23)(H2,21,27,28) |
| InChIKey | DCKQKPFMWWJPTJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 149.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |