C15H20O5S — CID 94779855
ethyl 3-[4-(2-methylpropanoyl)phenyl]sulfonylpropanoate (PubChem CID 94779855) has the molecular formula C15H20O5S and a molecular weight of 312.39 g/mol. Its IUPAC name is ethyl 3-[4-(2-methylpropanoyl)phenyl]sulfonylpropanoate.
| Compound Name | ethyl 3-[4-(2-methylpropanoyl)phenyl]sulfonylpropanoate |
|---|---|
| PubChem CID | 94779855 |
| Molecular Formula | C15H20O5S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | ethyl 3-[4-(2-methylpropanoyl)phenyl]sulfonylpropanoate |
| SMILES | CCOC(=O)CCS(=O)(=O)c1ccc(C(=O)C(C)C)cc1 |
| InChI | InChI=1S/C15H20O5S/c1-4-20-14(16)9-10-21(18,19)13-7-5-12(6-8-13)15(17)11(2)3/h5-8,11H,4,9-10H2,1-3H3 |
| InChIKey | AYGYQJIHZCGGPO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |