C17H26O4S — CID 71419522
5-(4-methylphenyl)sulfonylpentyl 2,2-dimethylpropanoate (PubChem CID 71419522) has the molecular formula C17H26O4S and a molecular weight of 326.46 g/mol. Its IUPAC name is 5-(4-methylphenyl)sulfonylpentyl 2,2-dimethylpropanoate.
| Compound Name | 5-(4-methylphenyl)sulfonylpentyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 71419522 |
| Molecular Formula | C17H26O4S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 5-(4-methylphenyl)sulfonylpentyl 2,2-dimethylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)CCCCCOC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H26O4S/c1-14-8-10-15(11-9-14)22(19,20)13-7-5-6-12-21-16(18)17(2,3)4/h8-11H,5-7,12-13H2,1-4H3 |
| InChIKey | GMIULKJQVYDIGN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|