C30H38ClO2P — CID 174154896
4-(2,2-dimethylpropanoyloxy)butyl-tris(4-methylphenyl)phosphanium chloride (PubChem CID 174154896) has the molecular formula C30H38ClO2P and a molecular weight of 497.06 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoyloxy)butyl-tris(4-methylphenyl)phosphanium chloride.
| Compound Name | 4-(2,2-dimethylpropanoyloxy)butyl-tris(4-methylphenyl)phosphanium chloride |
|---|---|
| PubChem CID | 174154896 |
| Molecular Formula | C30H38ClO2P |
| Molecular Weight | 497.06 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 4-(2,2-dimethylpropanoyloxy)butyl-tris(4-methylphenyl)phosphanium chloride |
| SMILES | Cc1ccc([P+](CCCCOC(=O)C(C)(C)C)(c2ccc(C)cc2)c2ccc(C)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C30H38O2P.ClH/c1-23-9-15-26(16-10-23)33(27-17-11-24(2)12-18-27,28-19-13-25(3)14-20-28)22-8-7-21-32-29(31)30(4,5)6;/h9-20H,7-8,21-22H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | FIZNEUSZHODFMH-UHFFFAOYSA-M |
| XLogP | 3.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.06 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|