C20H38O4Zn — CID 10971564
zinc bis(pentyl 2,2-dimethylpropanoate) (PubChem CID 10971564) has the molecular formula C20H38O4Zn and a molecular weight of 407.91 g/mol. Its IUPAC name is zinc bis(pentyl 2,2-dimethylpropanoate).
| Compound Name | zinc bis(pentyl 2,2-dimethylpropanoate) |
|---|---|
| PubChem CID | 10971564 |
| Molecular Formula | C20H38O4Zn |
| Molecular Weight | 407.91 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | zinc bis(pentyl 2,2-dimethylpropanoate) |
| SMILES | [CH2-]CCCCOC(=O)C(C)(C)C.[CH2-]CCCCOC(=O)C(C)(C)C.[Zn+2] |
| InChI | InChI=1S/2C10H19O2.Zn/c2*1-5-6-7-8-12-9(11)10(2,3)4;/h2*1,5-8H2,2-4H3;/q2*-1;+2 |
| InChIKey | PDLQYXSZCXZTCM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.91 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|