C16H30O4 — CID 151303076
[5-(2,2-dimethylpropanoyloxy)-4-methylpentyl] 2,2-dimethylpropanoate (PubChem CID 151303076) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is [5-(2,2-dimethylpropanoyloxy)-4-methylpentyl] 2,2-dimethylpropanoate.
| Compound Name | [5-(2,2-dimethylpropanoyloxy)-4-methylpentyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 151303076 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | [5-(2,2-dimethylpropanoyloxy)-4-methylpentyl] 2,2-dimethylpropanoate |
| SMILES | CC(CCCOC(=O)C(C)(C)C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H30O4/c1-12(11-20-14(18)16(5,6)7)9-8-10-19-13(17)15(2,3)4/h12H,8-11H2,1-7H3 |
| InChIKey | OCVDEOINEMUVBO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|