C16H27F3O5S — CID 122545219
[(4R)-4,6-dimethyl-7-(trifluoromethylsulfonyloxy)oct-7-enyl] 2,2-dimethylpropanoate (PubChem CID 122545219) has the molecular formula C16H27F3O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is [(4R)-4,6-dimethyl-7-(trifluoromethylsulfonyloxy)oct-7-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(4R)-4,6-dimethyl-7-(trifluoromethylsulfonyloxy)oct-7-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 122545219 |
| Molecular Formula | C16H27F3O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | [(4R)-4,6-dimethyl-7-(trifluoromethylsulfonyloxy)oct-7-enyl] 2,2-dimethylpropanoate |
| SMILES | C=C(OS(=O)(=O)C(F)(F)F)C(C)C[C@H](C)CCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H27F3O5S/c1-11(8-7-9-23-14(20)15(4,5)6)10-12(2)13(3)24-25(21,22)16(17,18)19/h11-12H,3,7-10H2,1-2,4-6H3/t11-,12?/m1/s1 |
| InChIKey | TYPMVLBTIWIDNU-JHJMLUEUSA-N |
| XLogP | 4.40 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|