C17H27F3O6S — CID 58077683
[(5R)-5-hydroxy-7-[(5S)-5-(3-hydroxypropyl)-3-methylideneoxolan-2-yl]-3-methylhept-1-en-2-yl] trifluoromethanesulfonate (PubChem CID 58077683) has the molecular formula C17H27F3O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is [(5R)-5-hydroxy-7-[(5S)-5-(3-hydroxypropyl)-3-methylideneoxolan-2-yl]-3-methylhept-1-en-2-yl] trifluoromethanesulfonate.
| Compound Name | [(5R)-5-hydroxy-7-[(5S)-5-(3-hydroxypropyl)-3-methylideneoxolan-2-yl]-3-methylhept-1-en-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58077683 |
| Molecular Formula | C17H27F3O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | [(5R)-5-hydroxy-7-[(5S)-5-(3-hydroxypropyl)-3-methylideneoxolan-2-yl]-3-methylhept-1-en-2-yl] trifluoromethanesulfonate |
| SMILES | C=C(OS(=O)(=O)C(F)(F)F)C(C)C[C@H](O)CCC1O[C@@H](CCCO)CC1=C |
| InChI | InChI=1S/C17H27F3O6S/c1-11(13(3)26-27(23,24)17(18,19)20)9-14(22)6-7-16-12(2)10-15(25-16)5-4-8-21/h11,14-16,21-22H,2-10H2,1H3/t11?,14-,15+,16?/m1/s1 |
| InChIKey | JXONUVFSQDUQRJ-SKLNQHAPSA-N |
| XLogP | 3.02 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|